About (3-chlorophenyl)-(4-cyanophenyl)borinic acid;quinolin-8-ol
(3-chlorophenyl)-(4-cyanophenyl)borinic acid;quinolin-8-ol (PubChem CID 69337211) has the molecular formula C22H16BClN2O2
and a molecular weight of 386.65 g/mol. Its IUPAC name is (3-chlorophenyl)-(4-cyanophenyl)borinic acid;quinolin-8-ol.
Molecular Properties
| Compound Name | (3-chlorophenyl)-(4-cyanophenyl)borinic acid;quinolin-8-ol |
| PubChem CID | 69337211 |
| Molecular Formula | C22H16BClN2O2 |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (3-chlorophenyl)-(4-cyanophenyl)borinic acid;quinolin-8-ol |
| SMILES | N#Cc1ccc(B(O)c2cccc(Cl)c2)cc1.Oc1cccc2cccnc12 |
| InChI | InChI=1S/C13H9BClNO.C9H7NO/c15-13-3-1-2-12(8-13)14(17)11-6-4-10(9-16)5-7-11;11-8-5-1-3-7-4-2-6-10-9(7)8/h1-8,17H;1-6,11H |
| InChIKey | MMKVJICSJQLHOO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-chlorophenyl)-(4-cyanophenyl)borinic acid;quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)-(4-cyanophenyl)borinic acid;quinolin-8-ol?
The IUPAC name of (3-chlorophenyl)-(4-cyanophenyl)borinic acid;quinolin-8-ol (CID 69337211) is (3-chlorophenyl)-(4-cyanophenyl)borinic acid;quinolin-8-ol.
What is the SMILES notation for (3-chlorophenyl)-(4-cyanophenyl)borinic acid;quinolin-8-ol?
The canonical SMILES for (3-chlorophenyl)-(4-cyanophenyl)borinic acid;quinolin-8-ol is N#Cc1ccc(B(O)c2cccc(Cl)c2)cc1.Oc1cccc2cccnc12.
What is the InChIKey of (3-chlorophenyl)-(4-cyanophenyl)borinic acid;quinolin-8-ol?
The InChIKey is MMKVJICSJQLHOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BClNO.C9H7NO/c15-13-3-1-2-12(8-13)14(17)11-6-4-10(9-16)5-7-11;11-8-5-1-3-7-4-2-6-10-9(7)8/h1-8,17H;1-6,11H.
What are the key properties of (3-chlorophenyl)-(4-cyanophenyl)borinic acid;quinolin-8-ol?
(3-chlorophenyl)-(4-cyanophenyl)borinic acid;quinolin-8-ol has a molecular weight of 386.65 g/mol, XLogP of 3.25, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)-(4-cyanophenyl)borinic acid;quinolin-8-ol is sourced from PubChem (CID 69337211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).