C4H7ClN4 — CID 69341462
5-chloro-3-methylimidazole-2,4-diamine (PubChem CID 69341462) has the molecular formula C4H7ClN4 and a molecular weight of 146.58 g/mol. Its IUPAC name is 5-chloro-3-methylimidazole-2,4-diamine.
| Compound Name | 5-chloro-3-methylimidazole-2,4-diamine |
|---|---|
| PubChem CID | 69341462 |
| Molecular Formula | C4H7ClN4 |
| Molecular Weight | 146.58 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | 5-chloro-3-methylimidazole-2,4-diamine |
| SMILES | Cn1c(N)nc(Cl)c1N |
| InChI | InChI=1S/C4H7ClN4/c1-9-3(6)2(5)8-4(9)7/h6H2,1H3,(H2,7,8) |
| InChIKey | WGNZBIMSGYRLMH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.58 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |