C12H14ClF3N3O+ — CID 6934206
1-[5-chloro-3-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide (PubChem CID 6934206) has the molecular formula C12H14ClF3N3O+ and a molecular weight of 308.71 g/mol. Its IUPAC name is 1-[5-chloro-3-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[5-chloro-3-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 6934206 |
| Molecular Formula | C12H14ClF3N3O+ |
| Molecular Weight | 308.71 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-[5-chloro-3-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2[nH+]cc(Cl)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H13ClF3N3O/c13-8-5-9(12(14,15)16)11(18-6-8)19-3-1-7(2-4-19)10(17)20/h5-7H,1-4H2,(H2,17,20)/p+1 |
| InChIKey | JCKVGGYAGCVCDH-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 60.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.71 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |