C10H11N3O2 — CID 69342392
2-amino-5-[(1,2-oxazol-5-ylamino)methyl]phenol (PubChem CID 69342392) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-amino-5-[(1,2-oxazol-5-ylamino)methyl]phenol.
| Compound Name | 2-amino-5-[(1,2-oxazol-5-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 69342392 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-amino-5-[(1,2-oxazol-5-ylamino)methyl]phenol |
| SMILES | Nc1ccc(CNc2ccno2)cc1O |
| InChI | InChI=1S/C10H11N3O2/c11-8-2-1-7(5-9(8)14)6-12-10-3-4-13-15-10/h1-5,12,14H,6,11H2 |
| InChIKey | JQIBUMOEHLQCFU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|