About [2-(3-amino-1H-indazol-5-yl)-1,3-oxazol-4-yl] hydrogen carbonate
[2-(3-amino-1H-indazol-5-yl)-1,3-oxazol-4-yl] hydrogen carbonate (PubChem CID 69351183) has the molecular formula C11H8N4O4
and a molecular weight of 260.21 g/mol. Its IUPAC name is [2-(3-amino-1H-indazol-5-yl)-1,3-oxazol-4-yl] hydrogen carbonate.
Analyze [2-(3-amino-1H-indazol-5-yl)-1,3-oxazol-4-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-amino-1H-indazol-5-yl)-1,3-oxazol-4-yl] hydrogen carbonate?
The IUPAC name of [2-(3-amino-1H-indazol-5-yl)-1,3-oxazol-4-yl] hydrogen carbonate (CID 69351183) is [2-(3-amino-1H-indazol-5-yl)-1,3-oxazol-4-yl] hydrogen carbonate.
What is the SMILES notation for [2-(3-amino-1H-indazol-5-yl)-1,3-oxazol-4-yl] hydrogen carbonate?
The canonical SMILES for [2-(3-amino-1H-indazol-5-yl)-1,3-oxazol-4-yl] hydrogen carbonate is Nc1n[nH]c2ccc(-c3nc(OC(=O)O)co3)cc12.
What is the InChIKey of [2-(3-amino-1H-indazol-5-yl)-1,3-oxazol-4-yl] hydrogen carbonate?
The InChIKey is NZGNLRAONWEAOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O4/c12-9-6-3-5(1-2-7(6)14-15-9)10-13-8(4-18-10)19-11(16)17/h1-4H,(H,16,17)(H3,12,14,15).
What are the key properties of [2-(3-amino-1H-indazol-5-yl)-1,3-oxazol-4-yl] hydrogen carbonate?
[2-(3-amino-1H-indazol-5-yl)-1,3-oxazol-4-yl] hydrogen carbonate has a molecular weight of 260.21 g/mol, XLogP of 1.86, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-amino-1H-indazol-5-yl)-1,3-oxazol-4-yl] hydrogen carbonate is sourced from PubChem (CID 69351183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).