C18H34N2+2 — CID 6935321
1-[[(1R)-cyclohex-3-en-1-yl]methyl]-4-(4-methylcyclohexyl)piperazine-1,4-diium (PubChem CID 6935321) has the molecular formula C18H34N2+2 and a molecular weight of 278.48 g/mol. Its IUPAC name is 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-4-(4-methylcyclohexyl)piperazine-1,4-diium.
| Compound Name | 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-4-(4-methylcyclohexyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 6935321 |
| Molecular Formula | C18H34N2+2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-4-(4-methylcyclohexyl)piperazine-1,4-diium |
| SMILES | CC1CCC([NH+]2CC[NH+](C[C@H]3CC=CCC3)CC2)CC1 |
| InChI | InChI=1S/C18H32N2/c1-16-7-9-18(10-8-16)20-13-11-19(12-14-20)15-17-5-3-2-4-6-17/h2-3,16-18H,4-15H2,1H3/p+2/t16?,17-,18?/m0/s1 |
| InChIKey | SOZFAPALWISQBU-ADKAHSJRSA-P |
| XLogP | 0.70 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|