C17H16F3N3O5S — CID 69356829
[(5S)-2-oxo-3-[4-[6-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,4-thiazin-4-yl]phenyl]-1,3-oxazolidin-5-yl]methylcarbamic acid (PubChem CID 69356829) has the molecular formula C17H16F3N3O5S and a molecular weight of 431.39 g/mol. Its IUPAC name is [(5S)-2-oxo-3-[4-[6-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,4-thiazin-4-yl]phenyl]-1,3-oxazolidin-5-yl]methylcarbamic acid.
| Compound Name | [(5S)-2-oxo-3-[4-[6-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,4-thiazin-4-yl]phenyl]-1,3-oxazolidin-5-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 69356829 |
| Molecular Formula | C17H16F3N3O5S |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | [(5S)-2-oxo-3-[4-[6-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,4-thiazin-4-yl]phenyl]-1,3-oxazolidin-5-yl]methylcarbamic acid |
| SMILES | O=C(O)NC[C@H]1CN(c2ccc(N3C=C(C(=O)C(F)(F)F)SCC3)cc2)C(=O)O1 |
| InChI | InChI=1S/C17H16F3N3O5S/c18-17(19,20)14(24)13-9-22(5-6-29-13)10-1-3-11(4-2-10)23-8-12(28-16(23)27)7-21-15(25)26/h1-4,9,12,21H,5-8H2,(H,25,26)/t12-/m0/s1 |
| InChIKey | QQQYVEMWDIBMPY-LBPRGKRZSA-N |
| XLogP | 2.81 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |