C21H24F3N3O7S — CID 20777129
tert-butyl N-[[3-[4-[1,1-dioxo-6-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,4-thiazin-4-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate (PubChem CID 20777129) has the molecular formula C21H24F3N3O7S and a molecular weight of 519.50 g/mol. Its IUPAC name is tert-butyl N-[[3-[4-[1,1-dioxo-6-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,4-thiazin-4-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[4-[1,1-dioxo-6-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,4-thiazin-4-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 20777129 |
| Molecular Formula | C21H24F3N3O7S |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | tert-butyl N-[[3-[4-[1,1-dioxo-6-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,4-thiazin-4-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CN(c2ccc(N3C=C(C(=O)C(F)(F)F)S(=O)(=O)CC3)cc2)C(=O)O1 |
| InChI | InChI=1S/C21H24F3N3O7S/c1-20(2,3)34-18(29)25-10-15-11-27(19(30)33-15)14-6-4-13(5-7-14)26-8-9-35(31,32)16(12-26)17(28)21(22,23)24/h4-7,12,15H,8-11H2,1-3H3,(H,25,29) |
| InChIKey | AZAKXFVQQKYFJP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |