C21H24F3N3O5S — CID 59997912
tert-butyl N-[[(5S)-2-oxo-3-[4-[6-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,4-thiazin-4-yl]phenyl]-1,3-oxazolidin-5-yl]methyl]carbamate (PubChem CID 59997912) has the molecular formula C21H24F3N3O5S and a molecular weight of 487.50 g/mol. Its IUPAC name is tert-butyl N-[[(5S)-2-oxo-3-[4-[6-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,4-thiazin-4-yl]phenyl]-1,3-oxazolidin-5-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(5S)-2-oxo-3-[4-[6-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,4-thiazin-4-yl]phenyl]-1,3-oxazolidin-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 59997912 |
| Molecular Formula | C21H24F3N3O5S |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | tert-butyl N-[[(5S)-2-oxo-3-[4-[6-(2,2,2-trifluoroacetyl)-2,3-dihydro-1,4-thiazin-4-yl]phenyl]-1,3-oxazolidin-5-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CN(c2ccc(N3C=C(C(=O)C(F)(F)F)SCC3)cc2)C(=O)O1 |
| InChI | InChI=1S/C21H24F3N3O5S/c1-20(2,3)32-18(29)25-10-15-11-27(19(30)31-15)14-6-4-13(5-7-14)26-8-9-33-16(12-26)17(28)21(22,23)24/h4-7,12,15H,8-11H2,1-3H3,(H,25,29)/t15-/m0/s1 |
| InChIKey | NVJXWZYHFOZFFK-HNNXBMFYSA-N |
| XLogP | 4.06 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |