C21H23Cl2N3O3 — CID 69359273
3-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-5-prop-2-enylbenzoic acid (PubChem CID 69359273) has the molecular formula C21H23Cl2N3O3 and a molecular weight of 436.34 g/mol. Its IUPAC name is 3-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-5-prop-2-enylbenzoic acid.
| Compound Name | 3-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-5-prop-2-enylbenzoic acid |
|---|---|
| PubChem CID | 69359273 |
| Molecular Formula | C21H23Cl2N3O3 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 3-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-5-prop-2-enylbenzoic acid |
| SMILES | C=CCc1cc(C(=O)O)cc(N2CCC(NC(=O)c3[nH]c(C)c(Cl)c3Cl)CC2)c1 |
| InChI | InChI=1S/C21H23Cl2N3O3/c1-3-4-13-9-14(21(28)29)11-16(10-13)26-7-5-15(6-8-26)25-20(27)19-18(23)17(22)12(2)24-19/h3,9-11,15,24H,1,4-8H2,2H3,(H,25,27)(H,28,29) |
| InChIKey | CGDXZDCXWCKCOL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|