C16H26N4O4 — CID 69365272
tert-butyl 4-[3-(1-hydroxyethoxy)pyrazin-2-yl]-2-methylpiperazine-1-carboxylate (PubChem CID 69365272) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is tert-butyl 4-[3-(1-hydroxyethoxy)pyrazin-2-yl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(1-hydroxyethoxy)pyrazin-2-yl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 69365272 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | tert-butyl 4-[3-(1-hydroxyethoxy)pyrazin-2-yl]-2-methylpiperazine-1-carboxylate |
| SMILES | CC(O)Oc1nccnc1N1CCN(C(=O)OC(C)(C)C)C(C)C1 |
| InChI | InChI=1S/C16H26N4O4/c1-11-10-19(8-9-20(11)15(22)24-16(3,4)5)13-14(23-12(2)21)18-7-6-17-13/h6-7,11-12,21H,8-10H2,1-5H3 |
| InChIKey | SCGZFZRXIDVBAR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|