C32H35N5O4S — CID 69368677
N-(2-hydroxypropan-2-yl)-N-[2-methyl-3-[4-methyl-5-oxo-6-[4-(1-oxo-1,4-thiazinan-4-yl)anilino]pyrazin-2-yl]phenyl]benzamide (PubChem CID 69368677) has the molecular formula C32H35N5O4S and a molecular weight of 585.73 g/mol. Its IUPAC name is N-(2-hydroxypropan-2-yl)-N-[2-methyl-3-[4-methyl-5-oxo-6-[4-(1-oxo-1,4-thiazinan-4-yl)anilino]pyrazin-2-yl]phenyl]benzamide.
| Compound Name | N-(2-hydroxypropan-2-yl)-N-[2-methyl-3-[4-methyl-5-oxo-6-[4-(1-oxo-1,4-thiazinan-4-yl)anilino]pyrazin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 69368677 |
| Molecular Formula | C32H35N5O4S |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | N-(2-hydroxypropan-2-yl)-N-[2-methyl-3-[4-methyl-5-oxo-6-[4-(1-oxo-1,4-thiazinan-4-yl)anilino]pyrazin-2-yl]phenyl]benzamide |
| SMILES | Cc1c(-c2cn(C)c(=O)c(Nc3ccc(N4CCS(=O)CC4)cc3)n2)cccc1N(C(=O)c1ccccc1)C(C)(C)O |
| InChI | InChI=1S/C32H35N5O4S/c1-22-26(11-8-12-28(22)37(32(2,3)40)30(38)23-9-6-5-7-10-23)27-21-35(4)31(39)29(34-27)33-24-13-15-25(16-14-24)36-17-19-42(41)20-18-36/h5-16,21,40H,17-20H2,1-4H3,(H,33,34) |
| InChIKey | ILHPDWOLOZNQNP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|