C14H11F3N2O3S — CID 69370652
2-amino-4H-indeno[1,2-b]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 69370652) has the molecular formula C14H11F3N2O3S and a molecular weight of 344.31 g/mol. Its IUPAC name is 2-amino-4H-indeno[1,2-b]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-amino-4H-indeno[1,2-b]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69370652 |
| Molecular Formula | C14H11F3N2O3S |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-amino-4H-indeno[1,2-b]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)c1c(N)sc2c1Cc1ccccc1-2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H10N2OS.C2HF3O2/c13-11(15)9-8-5-6-3-1-2-4-7(6)10(8)16-12(9)14;3-2(4,5)1(6)7/h1-4H,5,14H2,(H2,13,15);(H,6,7) |
| InChIKey | DMIHZIDLYLJOCM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|