C16H23N3OS — CID 145125122
2-amino-4H-indeno[2,1-b]thiophene-1-carbohydrazide;ethane (PubChem CID 145125122) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is 2-amino-4H-indeno[2,1-b]thiophene-1-carbohydrazide;ethane.
| Compound Name | 2-amino-4H-indeno[2,1-b]thiophene-1-carbohydrazide;ethane |
|---|---|
| PubChem CID | 145125122 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-amino-4H-indeno[2,1-b]thiophene-1-carbohydrazide;ethane |
| SMILES | CC.CC.NNC(=O)c1c(N)sc2c1-c1ccccc1C2 |
| InChI | InChI=1S/C12H11N3OS.2C2H6/c13-11-10(12(16)15-14)9-7-4-2-1-3-6(7)5-8(9)17-11;2*1-2/h1-4H,5,13-14H2,(H,15,16);2*1-2H3 |
| InChIKey | ROJZNGFSSMSEKM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|