C24H24Cl2FN3O2 — CID 69373437
1-[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]cyclohexan-1-ol (PubChem CID 69373437) has the molecular formula C24H24Cl2FN3O2 and a molecular weight of 476.38 g/mol. Its IUPAC name is 1-[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]cyclohexan-1-ol.
| Compound Name | 1-[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 69373437 |
| Molecular Formula | C24H24Cl2FN3O2 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 1-[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]cyclohexan-1-ol |
| SMILES | CC(Oc1cc(-c2ccc(C3(O)CCCCC3)nc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C24H24Cl2FN3O2/c1-14(21-17(25)6-7-18(27)22(21)26)32-19-11-16(13-30-23(19)28)15-5-8-20(29-12-15)24(31)9-3-2-4-10-24/h5-8,11-14,31H,2-4,9-10H2,1H3,(H2,28,30) |
| InChIKey | OREXCZCTKWPCBR-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|