C24H20Cl2N4O — CID 69374199
4-(2,4-dichloroanilino)-7-[2-(dimethylamino)ethoxy]benzo[h]quinoline-3-carbonitrile (PubChem CID 69374199) has the molecular formula C24H20Cl2N4O and a molecular weight of 451.36 g/mol. Its IUPAC name is 4-(2,4-dichloroanilino)-7-[2-(dimethylamino)ethoxy]benzo[h]quinoline-3-carbonitrile.
| Compound Name | 4-(2,4-dichloroanilino)-7-[2-(dimethylamino)ethoxy]benzo[h]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 69374199 |
| Molecular Formula | C24H20Cl2N4O |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 4-(2,4-dichloroanilino)-7-[2-(dimethylamino)ethoxy]benzo[h]quinoline-3-carbonitrile |
| SMILES | CN(C)CCOc1cccc2c1ccc1c(Nc3ccc(Cl)cc3Cl)c(C#N)cnc12 |
| InChI | InChI=1S/C24H20Cl2N4O/c1-30(2)10-11-31-22-5-3-4-18-17(22)7-8-19-23(15(13-27)14-28-24(18)19)29-21-9-6-16(25)12-20(21)26/h3-9,12,14H,10-11H2,1-2H3,(H,28,29) |
| InChIKey | FKFOJCFSAUCFCQ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|