C26H20Cl2N6O3 — CID 69373305
4-(2,4-dichloro-5-methoxyanilino)-7-methoxy-8-[2-(triazol-1-yl)ethoxy]benzo[h]quinoline-3-carbonitrile (PubChem CID 69373305) has the molecular formula C26H20Cl2N6O3 and a molecular weight of 535.39 g/mol. Its IUPAC name is 4-(2,4-dichloro-5-methoxyanilino)-7-methoxy-8-[2-(triazol-1-yl)ethoxy]benzo[h]quinoline-3-carbonitrile.
| Compound Name | 4-(2,4-dichloro-5-methoxyanilino)-7-methoxy-8-[2-(triazol-1-yl)ethoxy]benzo[h]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 69373305 |
| Molecular Formula | C26H20Cl2N6O3 |
| Molecular Weight | 535.39 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | 4-(2,4-dichloro-5-methoxyanilino)-7-methoxy-8-[2-(triazol-1-yl)ethoxy]benzo[h]quinoline-3-carbonitrile |
| SMILES | COc1cc(Nc2c(C#N)cnc3c2ccc2c(OC)c(OCCn4ccnn4)ccc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C26H20Cl2N6O3/c1-35-23-12-21(19(27)11-20(23)28)32-24-15(13-29)14-30-25-16-5-6-22(37-10-9-34-8-7-31-33-34)26(36-2)17(16)3-4-18(24)25/h3-8,11-12,14H,9-10H2,1-2H3,(H,30,32) |
| InChIKey | KDQFVBKUURYGQI-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.39 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|