C22H13ClF3N5 — CID 69374691
2-(2-chlorophenyl)-N-[1-(trifluoromethyl)indazol-3-yl]quinazolin-4-amine (PubChem CID 69374691) has the molecular formula C22H13ClF3N5 and a molecular weight of 439.83 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[1-(trifluoromethyl)indazol-3-yl]quinazolin-4-amine.
| Compound Name | 2-(2-chlorophenyl)-N-[1-(trifluoromethyl)indazol-3-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 69374691 |
| Molecular Formula | C22H13ClF3N5 |
| Molecular Weight | 439.83 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[1-(trifluoromethyl)indazol-3-yl]quinazolin-4-amine |
| SMILES | FC(F)(F)n1nc(Nc2nc(-c3ccccc3Cl)nc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C22H13ClF3N5/c23-16-10-4-1-7-13(16)19-27-17-11-5-2-8-14(17)20(28-19)29-21-15-9-3-6-12-18(15)31(30-21)22(24,25)26/h1-12H,(H,27,28,29,30) |
| InChIKey | DYCUJTLCPVCWHY-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.83 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |