C16H16F3N3O — CID 69375151
N-(1-pyridin-2-ylbutyl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 69375151) has the molecular formula C16H16F3N3O and a molecular weight of 323.32 g/mol. Its IUPAC name is N-(1-pyridin-2-ylbutyl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(1-pyridin-2-ylbutyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69375151 |
| Molecular Formula | C16H16F3N3O |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-(1-pyridin-2-ylbutyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CCCC(NC(=O)c1ccc(C(F)(F)F)nc1)c1ccccn1 |
| InChI | InChI=1S/C16H16F3N3O/c1-2-5-13(12-6-3-4-9-20-12)22-15(23)11-7-8-14(21-10-11)16(17,18)19/h3-4,6-10,13H,2,5H2,1H3,(H,22,23) |
| InChIKey | XTBBHYBHEOQBFR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |