C35H38N4O — CID 69376644
3-[[2-(dimethylamino)phenyl]methyl]-1H-indol-4-ol;N,N-dimethyl-1-(2-methyl-1H-indol-3-yl)-1-phenylmethanamine (PubChem CID 69376644) has the molecular formula C35H38N4O and a molecular weight of 530.72 g/mol. Its IUPAC name is 3-[[2-(dimethylamino)phenyl]methyl]-1H-indol-4-ol;N,N-dimethyl-1-(2-methyl-1H-indol-3-yl)-1-phenylmethanamine.
| Compound Name | 3-[[2-(dimethylamino)phenyl]methyl]-1H-indol-4-ol;N,N-dimethyl-1-(2-methyl-1H-indol-3-yl)-1-phenylmethanamine |
|---|---|
| PubChem CID | 69376644 |
| Molecular Formula | C35H38N4O |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 3-[[2-(dimethylamino)phenyl]methyl]-1H-indol-4-ol;N,N-dimethyl-1-(2-methyl-1H-indol-3-yl)-1-phenylmethanamine |
| SMILES | CN(C)c1ccccc1Cc1c[nH]c2cccc(O)c12.Cc1[nH]c2ccccc2c1C(c1ccccc1)N(C)C |
| InChI | InChI=1S/C18H20N2.C17H18N2O/c1-13-17(15-11-7-8-12-16(15)19-13)18(20(2)3)14-9-5-4-6-10-14;1-19(2)15-8-4-3-6-12(15)10-13-11-18-14-7-5-9-16(20)17(13)14/h4-12,18-19H,1-3H3;3-9,11,18,20H,10H2,1-2H3 |
| InChIKey | BRBQXUHWQONOPD-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|