C9H8N2O2S — CID 69378575
3-thiophen-2-yl-1,6-dihydropyridazine-4-carboxylic acid (PubChem CID 69378575) has the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. Its IUPAC name is 3-thiophen-2-yl-1,6-dihydropyridazine-4-carboxylic acid.
| Compound Name | 3-thiophen-2-yl-1,6-dihydropyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 69378575 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 3-thiophen-2-yl-1,6-dihydropyridazine-4-carboxylic acid |
| SMILES | O=C(O)C1=CCNN=C1c1cccs1 |
| InChI | InChI=1S/C9H8N2O2S/c12-9(13)6-3-4-10-11-8(6)7-2-1-5-14-7/h1-3,5,10H,4H2,(H,12,13) |
| InChIKey | LDHMDEBANSQGRK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |