C13H11NO2 — CID 69379153
4,5-dihydro-3H-benzo[e]indole-1-carboxylic acid (PubChem CID 69379153) has the molecular formula C13H11NO2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 4,5-dihydro-3H-benzo[e]indole-1-carboxylic acid.
| Compound Name | 4,5-dihydro-3H-benzo[e]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 69379153 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 4,5-dihydro-3H-benzo[e]indole-1-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c2c1-c1ccccc1CC2 |
| InChI | InChI=1S/C13H11NO2/c15-13(16)10-7-14-11-6-5-8-3-1-2-4-9(8)12(10)11/h1-4,7,14H,5-6H2,(H,15,16) |
| InChIKey | DEQPZSNYDZORDA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |