C20H24FN2O2+ — CID 6937979
ethyl (2R)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-2-phenylacetate (PubChem CID 6937979) has the molecular formula C20H24FN2O2+ and a molecular weight of 343.42 g/mol. Its IUPAC name is ethyl (2R)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-2-phenylacetate.
| Compound Name | ethyl (2R)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 6937979 |
| Molecular Formula | C20H24FN2O2+ |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | ethyl (2R)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-2-phenylacetate |
| SMILES | CCOC(=O)[C@@H](c1ccccc1)[NH+]1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H23FN2O2/c1-2-25-20(24)19(16-8-4-3-5-9-16)23-14-12-22(13-15-23)18-11-7-6-10-17(18)21/h3-11,19H,2,12-15H2,1H3/p+1/t19-/m1/s1 |
| InChIKey | CNIGVBAGXCPSOC-LJQANCHMSA-O |
| XLogP | 1.84 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |