C47H69N5 — CID 69380675
6-(4-ethylphenyl)-2-N,4-N-bis(3,4,5-tributylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 69380675) has the molecular formula C47H69N5 and a molecular weight of 704.10 g/mol. Its IUPAC name is 6-(4-ethylphenyl)-2-N,4-N-bis(3,4,5-tributylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(4-ethylphenyl)-2-N,4-N-bis(3,4,5-tributylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 69380675 |
| Molecular Formula | C47H69N5 |
| Molecular Weight | 704.10 g/mol |
| Exact Mass | 703.56 |
| IUPAC Name | 6-(4-ethylphenyl)-2-N,4-N-bis(3,4,5-tributylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCc1cc(Nc2nc(Nc3cc(CCCC)c(CCCC)c(CCCC)c3)nc(-c3ccc(CC)cc3)n2)cc(CCCC)c1CCCC |
| InChI | InChI=1S/C47H69N5/c1-8-15-21-37-31-41(32-38(22-16-9-2)43(37)25-19-12-5)48-46-50-45(36-29-27-35(14-7)28-30-36)51-47(52-46)49-42-33-39(23-17-10-3)44(26-20-13-6)40(34-42)24-18-11-4/h27-34H,8-26H2,1-7H3,(H2,48,49,50,51,52) |
| InChIKey | WSFIHUJXRYLOIF-UHFFFAOYSA-N |
| XLogP | 13.64 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.10 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |