C16H24NO+ — CID 6938459
benzyl-[[(1R)-cyclohex-3-en-1-yl]methyl]-(2-hydroxyethyl)azanium (PubChem CID 6938459) has the molecular formula C16H24NO+ and a molecular weight of 246.37 g/mol. Its IUPAC name is benzyl-[[(1R)-cyclohex-3-en-1-yl]methyl]-(2-hydroxyethyl)azanium.
| Compound Name | benzyl-[[(1R)-cyclohex-3-en-1-yl]methyl]-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 6938459 |
| Molecular Formula | C16H24NO+ |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | benzyl-[[(1R)-cyclohex-3-en-1-yl]methyl]-(2-hydroxyethyl)azanium |
| SMILES | OCC[NH+](Cc1ccccc1)C[C@H]1CC=CCC1 |
| InChI | InChI=1S/C16H23NO/c18-12-11-17(13-15-7-3-1-4-8-15)14-16-9-5-2-6-10-16/h1-5,7-8,16,18H,6,9-14H2/p+1/t16-/m0/s1 |
| InChIKey | HHDWJOMSNUIHJG-INIZCTEOSA-O |
| XLogP | 1.42 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|