C16H18Cl2NO+ — CID 6943185
benzyl-[(2,4-dichlorophenyl)methyl]-(2-hydroxyethyl)azanium (PubChem CID 6943185) has the molecular formula C16H18Cl2NO+ and a molecular weight of 311.23 g/mol. Its IUPAC name is benzyl-[(2,4-dichlorophenyl)methyl]-(2-hydroxyethyl)azanium.
| Compound Name | benzyl-[(2,4-dichlorophenyl)methyl]-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 6943185 |
| Molecular Formula | C16H18Cl2NO+ |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | benzyl-[(2,4-dichlorophenyl)methyl]-(2-hydroxyethyl)azanium |
| SMILES | OCC[NH+](Cc1ccccc1)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2NO/c17-15-7-6-14(16(18)10-15)12-19(8-9-20)11-13-4-2-1-3-5-13/h1-7,10,20H,8-9,11-12H2/p+1 |
| InChIKey | CLOAXCIPFMCRNI-UHFFFAOYSA-O |
| XLogP | 2.57 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |