C30H29Cl4N3O7 — CID 69390160
tert-butyl 2-[5-[[acetyl-[6,6-dichloro-5-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]cyclohexa-2,4-dien-1-yl]amino]methyl]-2-oxo-1,3-dioxol-4-yl]pyrrolidine-1-carboxylate (PubChem CID 69390160) has the molecular formula C30H29Cl4N3O7 and a molecular weight of 685.39 g/mol. Its IUPAC name is tert-butyl 2-[5-[[acetyl-[6,6-dichloro-5-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]cyclohexa-2,4-dien-1-yl]amino]methyl]-2-oxo-1,3-dioxol-4-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[5-[[acetyl-[6,6-dichloro-5-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]cyclohexa-2,4-dien-1-yl]amino]methyl]-2-oxo-1,3-dioxol-4-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69390160 |
| Molecular Formula | C30H29Cl4N3O7 |
| Molecular Weight | 685.39 g/mol |
| Exact Mass | 683.08 |
| IUPAC Name | tert-butyl 2-[5-[[acetyl-[6,6-dichloro-5-[3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]cyclohexa-2,4-dien-1-yl]amino]methyl]-2-oxo-1,3-dioxol-4-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)N(Cc1oc(=O)oc1C1CCCN1C(=O)OC(C)(C)C)C1C=CC=C(c2cc(-c3c(Cl)cccc3Cl)no2)C1(Cl)Cl |
| InChI | InChI=1S/C30H29Cl4N3O7/c1-16(38)37(15-23-26(42-28(40)41-23)21-11-7-13-36(21)27(39)43-29(2,3)4)24-12-5-8-17(30(24,33)34)22-14-20(35-44-22)25-18(31)9-6-10-19(25)32/h5-6,8-10,12,14,21,24H,7,11,13,15H2,1-4H3 |
| InChIKey | DVCVGJGWWOUOSY-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 119.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.39 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|