C25H36O4 — CID 69403005
3-[4-[4-(3-hydroxypropyl)phenoxy]butoxy]-2-methyl-6-(3-methylbutyl)phenol (PubChem CID 69403005) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 3-[4-[4-(3-hydroxypropyl)phenoxy]butoxy]-2-methyl-6-(3-methylbutyl)phenol.
| Compound Name | 3-[4-[4-(3-hydroxypropyl)phenoxy]butoxy]-2-methyl-6-(3-methylbutyl)phenol |
|---|---|
| PubChem CID | 69403005 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 3-[4-[4-(3-hydroxypropyl)phenoxy]butoxy]-2-methyl-6-(3-methylbutyl)phenol |
| SMILES | Cc1c(OCCCCOc2ccc(CCCO)cc2)ccc(CCC(C)C)c1O |
| InChI | InChI=1S/C25H36O4/c1-19(2)8-11-22-12-15-24(20(3)25(22)27)29-18-5-4-17-28-23-13-9-21(10-14-23)7-6-16-26/h9-10,12-15,19,26-27H,4-8,11,16-18H2,1-3H3 |
| InChIKey | KFVGWUBVLIZMHF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|