C5H5N5 — CID 69403299
5-methyl-2H-triazolo[4,5-d]pyrimidine (PubChem CID 69403299) has the molecular formula C5H5N5 and a molecular weight of 135.13 g/mol. Its IUPAC name is 5-methyl-2H-triazolo[4,5-d]pyrimidine.
| Compound Name | 5-methyl-2H-triazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 69403299 |
| Molecular Formula | C5H5N5 |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 5-methyl-2H-triazolo[4,5-d]pyrimidine |
| SMILES | Cc1ncc2n[nH]nc2n1 |
| InChI | InChI=1S/C5H5N5/c1-3-6-2-4-5(7-3)9-10-8-4/h2H,1H3,(H,6,7,8,9,10) |
| InChIKey | AQCRDOMQPWPHSC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |