C39H45N7O2 — CID 69404046
1,3-dimethyl-7-[2-(pyridin-3-ylmethylamino)ethyl]purine-2,6-dione;3,3-diphenyl-N-(1-phenylpropan-2-yl)propan-1-amine (PubChem CID 69404046) has the molecular formula C39H45N7O2 and a molecular weight of 643.84 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-(pyridin-3-ylmethylamino)ethyl]purine-2,6-dione;3,3-diphenyl-N-(1-phenylpropan-2-yl)propan-1-amine.
| Compound Name | 1,3-dimethyl-7-[2-(pyridin-3-ylmethylamino)ethyl]purine-2,6-dione;3,3-diphenyl-N-(1-phenylpropan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 69404046 |
| Molecular Formula | C39H45N7O2 |
| Molecular Weight | 643.84 g/mol |
| Exact Mass | 643.36 |
| IUPAC Name | 1,3-dimethyl-7-[2-(pyridin-3-ylmethylamino)ethyl]purine-2,6-dione;3,3-diphenyl-N-(1-phenylpropan-2-yl)propan-1-amine |
| SMILES | CC(Cc1ccccc1)NCCC(c1ccccc1)c1ccccc1.Cn1c(=O)c2c(ncn2CCNCc2cccnc2)n(C)c1=O |
| InChI | InChI=1S/C24H27N.C15H18N6O2/c1-20(19-21-11-5-2-6-12-21)25-18-17-24(22-13-7-3-8-14-22)23-15-9-4-10-16-23;1-19-13-12(14(22)20(2)15(19)23)21(10-18-13)7-6-17-9-11-4-3-5-16-8-11/h2-16,20,24-25H,17-19H2,1H3;3-5,8,10,17H,6-7,9H2,1-2H3 |
| InChIKey | NJQBZEMHEASCMQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.84 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|