C19H25ClN5O2- — CID 110176328
1,3-dimethyl-7-[2-methyl-3-(2-phenylethylamino)propyl]purine-2,6-dione chloride (PubChem CID 110176328) has the molecular formula C19H25ClN5O2- and a molecular weight of 390.90 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-methyl-3-(2-phenylethylamino)propyl]purine-2,6-dione chloride.
| Compound Name | 1,3-dimethyl-7-[2-methyl-3-(2-phenylethylamino)propyl]purine-2,6-dione chloride |
|---|---|
| PubChem CID | 110176328 |
| Molecular Formula | C19H25ClN5O2- |
| Molecular Weight | 390.90 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1,3-dimethyl-7-[2-methyl-3-(2-phenylethylamino)propyl]purine-2,6-dione chloride |
| SMILES | CC(CNCCc1ccccc1)Cn1cnc2c1c(=O)n(C)c(=O)n2C.[Cl-] |
| InChI | InChI=1S/C19H25N5O2.ClH/c1-14(11-20-10-9-15-7-5-4-6-8-15)12-24-13-21-17-16(24)18(25)23(3)19(26)22(17)2;/h4-8,13-14,20H,9-12H2,1-3H3;1H/p-1 |
| InChIKey | MIYSOUDJQRXAMZ-UHFFFAOYSA-M |
| XLogP | -2.09 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.90 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|