C22H20N+ — CID 69405902
1-(1,3-diphenylpenta-1,4-dien-2-yl)pyridin-1-ium (PubChem CID 69405902) has the molecular formula C22H20N+ and a molecular weight of 298.41 g/mol. Its IUPAC name is 1-(1,3-diphenylpenta-1,4-dien-2-yl)pyridin-1-ium.
| Compound Name | 1-(1,3-diphenylpenta-1,4-dien-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 69405902 |
| Molecular Formula | C22H20N+ |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 1-(1,3-diphenylpenta-1,4-dien-2-yl)pyridin-1-ium |
| SMILES | C=CC(C(=Cc1ccccc1)[n+]1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20N/c1-2-21(20-14-8-4-9-15-20)22(23-16-10-5-11-17-23)18-19-12-6-3-7-13-19/h2-18,21H,1H2/q+1 |
| InChIKey | AVIWIFAYOGNFLY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|