C34H38Cl2N2O3 — CID 69409248
(6aR)-N-cyclopropyl-5-[4-[2-(2,6-dichlorophenoxy)ethoxy]phenyl]-N-[(2,3-dimethylphenyl)methyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-4-carboxamide (PubChem CID 69409248) has the molecular formula C34H38Cl2N2O3 and a molecular weight of 593.60 g/mol. Its IUPAC name is (6aR)-N-cyclopropyl-5-[4-[2-(2,6-dichlorophenoxy)ethoxy]phenyl]-N-[(2,3-dimethylphenyl)methyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-4-carboxamide.
| Compound Name | (6aR)-N-cyclopropyl-5-[4-[2-(2,6-dichlorophenoxy)ethoxy]phenyl]-N-[(2,3-dimethylphenyl)methyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 69409248 |
| Molecular Formula | C34H38Cl2N2O3 |
| Molecular Weight | 593.60 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | (6aR)-N-cyclopropyl-5-[4-[2-(2,6-dichlorophenoxy)ethoxy]phenyl]-N-[(2,3-dimethylphenyl)methyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-4-carboxamide |
| SMILES | Cc1cccc(CN(C(=O)C2C(c3ccc(OCCOc4c(Cl)cccc4Cl)cc3)C[C@H]3CNCC23)C2CC2)c1C |
| InChI | InChI=1S/C34H38Cl2N2O3/c1-21-5-3-6-24(22(21)2)20-38(26-11-12-26)34(39)32-28(17-25-18-37-19-29(25)32)23-9-13-27(14-10-23)40-15-16-41-33-30(35)7-4-8-31(33)36/h3-10,13-14,25-26,28-29,32,37H,11-12,15-20H2,1-2H3/t25-,28?,29?,32?/m0/s1 |
| InChIKey | BYZVGWFMRZLSOX-UFWODMKISA-N |
| XLogP | 7.20 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|