C33H38Cl2FN3O3 — CID 67984427
N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-2-fluoroanilino]-N-[(2,3-dimethylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 67984427) has the molecular formula C33H38Cl2FN3O3 and a molecular weight of 614.59 g/mol. Its IUPAC name is N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-2-fluoroanilino]-N-[(2,3-dimethylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-2-fluoroanilino]-N-[(2,3-dimethylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 67984427 |
| Molecular Formula | C33H38Cl2FN3O3 |
| Molecular Weight | 614.59 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-2-fluoroanilino]-N-[(2,3-dimethylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(Cl)c(OCCOc2ccc(NC3CCNCC3C(=O)N(Cc3cccc(C)c3C)C3CC3)c(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C33H38Cl2FN3O3/c1-20-15-27(34)32(28(35)16-20)42-14-13-41-25-9-10-31(29(36)17-25)38-30-11-12-37-18-26(30)33(40)39(24-7-8-24)19-23-6-4-5-21(2)22(23)3/h4-6,9-10,15-17,24,26,30,37-38H,7-8,11-14,18-19H2,1-3H3 |
| InChIKey | OSCMWMVLTQPUHP-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.59 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|