C33H38Cl3N3O5 — CID 66771821
(4S)-N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]anilino]-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)piperidine-3-carboxamide;hydrochloride (PubChem CID 66771821) has the molecular formula C33H38Cl3N3O5 and a molecular weight of 663.04 g/mol. Its IUPAC name is (4S)-N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]anilino]-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)piperidine-3-carboxamide;hydrochloride.
| Compound Name | (4S)-N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]anilino]-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 66771821 |
| Molecular Formula | C33H38Cl3N3O5 |
| Molecular Weight | 663.04 g/mol |
| Exact Mass | 661.19 |
| IUPAC Name | (4S)-N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]anilino]-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)piperidine-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(Cl)c(OCCOc2ccc(N[C@H]3CCNCC3C(=O)N(Cc3cccc4c3OCCO4)C3CC3)cc2)c(Cl)c1.Cl |
| InChI | InChI=1S/C33H37Cl2N3O5.ClH/c1-21-17-27(34)32(28(35)18-21)43-15-13-40-25-9-5-23(6-10-25)37-29-11-12-36-19-26(29)33(39)38(24-7-8-24)20-22-3-2-4-30-31(22)42-16-14-41-30;/h2-6,9-10,17-18,24,26,29,36-37H,7-8,11-16,19-20H2,1H3;1H/t26?,29-;/m0./s1 |
| InChIKey | ASSAEIISEMOQNW-ZOBDXOMCSA-N |
| XLogP | 6.53 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.04 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|