C33H36Cl3N3O5 — CID 67984252
4-[2-chloro-4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]anilino]-N-cyclopropyl-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)piperidine-3-carboxamide (PubChem CID 67984252) has the molecular formula C33H36Cl3N3O5 and a molecular weight of 661.03 g/mol. Its IUPAC name is 4-[2-chloro-4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]anilino]-N-cyclopropyl-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)piperidine-3-carboxamide.
| Compound Name | 4-[2-chloro-4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]anilino]-N-cyclopropyl-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 67984252 |
| Molecular Formula | C33H36Cl3N3O5 |
| Molecular Weight | 661.03 g/mol |
| Exact Mass | 659.17 |
| IUPAC Name | 4-[2-chloro-4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]anilino]-N-cyclopropyl-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)piperidine-3-carboxamide |
| SMILES | Cc1cc(Cl)c(OCCOc2ccc(NC3CCNCC3C(=O)N(Cc3cccc4c3OCCO4)C3CC3)c(Cl)c2)c(Cl)c1 |
| InChI | InChI=1S/C33H36Cl3N3O5/c1-20-15-26(35)32(27(36)16-20)44-13-11-41-23-7-8-29(25(34)17-23)38-28-9-10-37-18-24(28)33(40)39(22-5-6-22)19-21-3-2-4-30-31(21)43-14-12-42-30/h2-4,7-8,15-17,22,24,28,37-38H,5-6,9-14,18-19H2,1H3 |
| InChIKey | TZYYKSKZHHIVEN-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.03 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|