C12H16N2O7S2 — CID 69412620
methyl 3-[4-[bis(methylsulfonyl)amino]anilino]-3-oxopropanoate (PubChem CID 69412620) has the molecular formula C12H16N2O7S2 and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl 3-[4-[bis(methylsulfonyl)amino]anilino]-3-oxopropanoate.
| Compound Name | methyl 3-[4-[bis(methylsulfonyl)amino]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 69412620 |
| Molecular Formula | C12H16N2O7S2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | methyl 3-[4-[bis(methylsulfonyl)amino]anilino]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)Nc1ccc(N(S(C)(=O)=O)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H16N2O7S2/c1-21-12(16)8-11(15)13-9-4-6-10(7-5-9)14(22(2,17)18)23(3,19)20/h4-7H,8H2,1-3H3,(H,13,15) |
| InChIKey | NASBNKZBMRNUEN-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|