C19H19BrF2NO4P — CID 69413908
[[2-bromo-4-[(7-methoxy-2,3-dimethylindol-1-yl)methyl]phenyl]methyl-fluorooxyphosphoryl] hypofluorite (PubChem CID 69413908) has the molecular formula C19H19BrF2NO4P and a molecular weight of 474.24 g/mol. Its IUPAC name is [[2-bromo-4-[(7-methoxy-2,3-dimethylindol-1-yl)methyl]phenyl]methyl-fluorooxyphosphoryl] hypofluorite.
| Compound Name | [[2-bromo-4-[(7-methoxy-2,3-dimethylindol-1-yl)methyl]phenyl]methyl-fluorooxyphosphoryl] hypofluorite |
|---|---|
| PubChem CID | 69413908 |
| Molecular Formula | C19H19BrF2NO4P |
| Molecular Weight | 474.24 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | [[2-bromo-4-[(7-methoxy-2,3-dimethylindol-1-yl)methyl]phenyl]methyl-fluorooxyphosphoryl] hypofluorite |
| SMILES | COc1cccc2c(C)c(C)n(Cc3ccc(CP(=O)(OF)OF)c(Br)c3)c12 |
| InChI | InChI=1S/C19H19BrF2NO4P/c1-12-13(2)23(19-16(12)5-4-6-18(19)25-3)10-14-7-8-15(17(20)9-14)11-28(24,26-21)27-22/h4-9H,10-11H2,1-3H3 |
| InChIKey | OPHFHAUUQGDEON-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.24 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|