C22H25BrF2NO6P — CID 24861696
[[2-bromo-4-[[3-(diethoxymethyl)-7-methoxyindol-1-yl]methyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 24861696) has the molecular formula C22H25BrF2NO6P and a molecular weight of 548.32 g/mol. Its IUPAC name is [[2-bromo-4-[[3-(diethoxymethyl)-7-methoxyindol-1-yl]methyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[[3-(diethoxymethyl)-7-methoxyindol-1-yl]methyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 24861696 |
| Molecular Formula | C22H25BrF2NO6P |
| Molecular Weight | 548.32 g/mol |
| Exact Mass | 547.06 |
| IUPAC Name | [[2-bromo-4-[[3-(diethoxymethyl)-7-methoxyindol-1-yl]methyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | CCOC(OCC)c1cn(Cc2ccc(C(F)(F)P(=O)(O)O)c(Br)c2)c2c(OC)cccc12 |
| InChI | InChI=1S/C22H25BrF2NO6P/c1-4-31-21(32-5-2)16-13-26(20-15(16)7-6-8-19(20)30-3)12-14-9-10-17(18(23)11-14)22(24,25)33(27,28)29/h6-11,13,21H,4-5,12H2,1-3H3,(H2,27,28,29) |
| InChIKey | JGMKLKGBKOSIQJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.32 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|