C24H36N2O2S — CID 69421248
N-[(1S,4R)-4-[(3S)-3-cyclohexylpiperidin-1-yl]cyclopent-2-en-1-yl]-N,3-dimethylbenzenesulfonamide (PubChem CID 69421248) has the molecular formula C24H36N2O2S and a molecular weight of 416.63 g/mol. Its IUPAC name is N-[(1S,4R)-4-[(3S)-3-cyclohexylpiperidin-1-yl]cyclopent-2-en-1-yl]-N,3-dimethylbenzenesulfonamide.
| Compound Name | N-[(1S,4R)-4-[(3S)-3-cyclohexylpiperidin-1-yl]cyclopent-2-en-1-yl]-N,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 69421248 |
| Molecular Formula | C24H36N2O2S |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | N-[(1S,4R)-4-[(3S)-3-cyclohexylpiperidin-1-yl]cyclopent-2-en-1-yl]-N,3-dimethylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)N(C)[C@@H]2C=C[C@H](N3CCC[C@@H](C4CCCCC4)C3)C2)c1 |
| InChI | InChI=1S/C24H36N2O2S/c1-19-8-6-12-24(16-19)29(27,28)25(2)22-13-14-23(17-22)26-15-7-11-21(18-26)20-9-4-3-5-10-20/h6,8,12-14,16,20-23H,3-5,7,9-11,15,17-18H2,1-2H3/t21-,22-,23+/m1/s1 |
| InChIKey | CGLGHTZDDHSCSH-ZLNRFVROSA-N |
| XLogP | 4.60 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|