C19H26ClF3N2O2S — CID 69420296
N,3-dimethyl-N-[(1S,4R)-4-[4-(trifluoromethyl)piperidin-1-yl]cyclopent-2-en-1-yl]benzenesulfonamide;hydrochloride (PubChem CID 69420296) has the molecular formula C19H26ClF3N2O2S and a molecular weight of 438.94 g/mol. Its IUPAC name is N,3-dimethyl-N-[(1S,4R)-4-[4-(trifluoromethyl)piperidin-1-yl]cyclopent-2-en-1-yl]benzenesulfonamide;hydrochloride.
| Compound Name | N,3-dimethyl-N-[(1S,4R)-4-[4-(trifluoromethyl)piperidin-1-yl]cyclopent-2-en-1-yl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 69420296 |
| Molecular Formula | C19H26ClF3N2O2S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N,3-dimethyl-N-[(1S,4R)-4-[4-(trifluoromethyl)piperidin-1-yl]cyclopent-2-en-1-yl]benzenesulfonamide;hydrochloride |
| SMILES | Cc1cccc(S(=O)(=O)N(C)[C@@H]2C=C[C@H](N3CCC(C(F)(F)F)CC3)C2)c1.Cl |
| InChI | InChI=1S/C19H25F3N2O2S.ClH/c1-14-4-3-5-18(12-14)27(25,26)23(2)16-6-7-17(13-16)24-10-8-15(9-11-24)19(20,21)22;/h3-7,12,15-17H,8-11,13H2,1-2H3;1H/t16-,17+;/m1./s1 |
| InChIKey | WKWDQJOSCZHYAH-PPPUBMIESA-N |
| XLogP | 4.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|