C15H19NO4S — CID 69421052
[(1R,4S)-4-[methyl-(3-methylphenyl)sulfonylamino]cyclopent-2-en-1-yl] acetate (PubChem CID 69421052) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is [(1R,4S)-4-[methyl-(3-methylphenyl)sulfonylamino]cyclopent-2-en-1-yl] acetate.
| Compound Name | [(1R,4S)-4-[methyl-(3-methylphenyl)sulfonylamino]cyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 69421052 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | [(1R,4S)-4-[methyl-(3-methylphenyl)sulfonylamino]cyclopent-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](N(C)S(=O)(=O)c2cccc(C)c2)C1 |
| InChI | InChI=1S/C15H19NO4S/c1-11-5-4-6-15(9-11)21(18,19)16(3)13-7-8-14(10-13)20-12(2)17/h4-9,13-14H,10H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | KJLOYLFSKMBGQU-KGLIPLIRSA-N |
| XLogP | 1.88 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|