C19H28N2O2S — CID 70035700
N,3-dimethyl-N-[(1S)-4-(4-methylpiperidin-1-yl)cyclopent-2-en-1-yl]benzenesulfonamide (PubChem CID 70035700) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is N,3-dimethyl-N-[(1S)-4-(4-methylpiperidin-1-yl)cyclopent-2-en-1-yl]benzenesulfonamide.
| Compound Name | N,3-dimethyl-N-[(1S)-4-(4-methylpiperidin-1-yl)cyclopent-2-en-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 70035700 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | N,3-dimethyl-N-[(1S)-4-(4-methylpiperidin-1-yl)cyclopent-2-en-1-yl]benzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)N(C)[C@@H]2C=CC(N3CCC(C)CC3)C2)c1 |
| InChI | InChI=1S/C19H28N2O2S/c1-15-9-11-21(12-10-15)18-8-7-17(14-18)20(3)24(22,23)19-6-4-5-16(2)13-19/h4-8,13,15,17-18H,9-12,14H2,1-3H3/t17-,18?/m1/s1 |
| InChIKey | QPFQLAGLACUCCM-QNSVNVJESA-N |
| XLogP | 3.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|