C20H28FN2+ — CID 6942985
1-(2-fluorophenyl)-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]piperazin-4-ium (PubChem CID 6942985) has the molecular formula C20H28FN2+ and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]piperazin-4-ium.
| Compound Name | 1-(2-fluorophenyl)-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 6942985 |
| Molecular Formula | C20H28FN2+ |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 1-(2-fluorophenyl)-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]piperazin-4-ium |
| SMILES | C=C(C)[C@@H]1CC=C(C[NH+]2CCN(c3ccccc3F)CC2)CC1 |
| InChI | InChI=1S/C20H27FN2/c1-16(2)18-9-7-17(8-10-18)15-22-11-13-23(14-12-22)20-6-4-3-5-19(20)21/h3-7,18H,1,8-15H2,2H3/p+1/t18-/m1/s1 |
| InChIKey | GZPDUQPUQOPPBP-GOSISDBHSA-O |
| XLogP | 2.83 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|