C9H9Cl2N5 — CID 69431441
3,4-dichloro-N-[(2-methyltetrazol-5-yl)methyl]aniline (PubChem CID 69431441) has the molecular formula C9H9Cl2N5 and a molecular weight of 258.11 g/mol. Its IUPAC name is 3,4-dichloro-N-[(2-methyltetrazol-5-yl)methyl]aniline.
| Compound Name | 3,4-dichloro-N-[(2-methyltetrazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 69431441 |
| Molecular Formula | C9H9Cl2N5 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 3,4-dichloro-N-[(2-methyltetrazol-5-yl)methyl]aniline |
| SMILES | Cn1nnc(CNc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C9H9Cl2N5/c1-16-14-9(13-15-16)5-12-6-2-3-7(10)8(11)4-6/h2-4,12H,5H2,1H3 |
| InChIKey | YTGNOYFVYTUIJU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |