C23H20N2O5S — CID 69432044
2-[(4-hydroxy-1-naphthalen-2-ylsulfonylpyrrolidin-2-yl)methyl]isoindole-1,3-dione (PubChem CID 69432044) has the molecular formula C23H20N2O5S and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-[(4-hydroxy-1-naphthalen-2-ylsulfonylpyrrolidin-2-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(4-hydroxy-1-naphthalen-2-ylsulfonylpyrrolidin-2-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 69432044 |
| Molecular Formula | C23H20N2O5S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2-[(4-hydroxy-1-naphthalen-2-ylsulfonylpyrrolidin-2-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC1CC(O)CN1S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H20N2O5S/c26-18-12-17(13-24-22(27)20-7-3-4-8-21(20)23(24)28)25(14-18)31(29,30)19-10-9-15-5-1-2-6-16(15)11-19/h1-11,17-18,26H,12-14H2 |
| InChIKey | HAVYUTSUQUSESU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|