C15H20N2O2 — CID 69435789
4-but-2-ynoxy-6-[(1R,2R)-2-methylcyclohexyl]oxypyrimidine (PubChem CID 69435789) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-but-2-ynoxy-6-[(1R,2R)-2-methylcyclohexyl]oxypyrimidine.
| Compound Name | 4-but-2-ynoxy-6-[(1R,2R)-2-methylcyclohexyl]oxypyrimidine |
|---|---|
| PubChem CID | 69435789 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 4-but-2-ynoxy-6-[(1R,2R)-2-methylcyclohexyl]oxypyrimidine |
| SMILES | CC#CCOc1cc(O[C@@H]2CCCC[C@H]2C)ncn1 |
| InChI | InChI=1S/C15H20N2O2/c1-3-4-9-18-14-10-15(17-11-16-14)19-13-8-6-5-7-12(13)2/h10-13H,5-9H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | CEBXOKKMKYFKQI-CHWSQXEVSA-N |
| XLogP | 2.84 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|