C17H21N4O3+ — CID 6943822
1-[(2R,3S)-3-(4-nitrophenyl)-4,5-diaza-1-azoniatricyclo[5.2.2.02,6]undec-5-en-4-yl]propan-1-one (PubChem CID 6943822) has the molecular formula C17H21N4O3+ and a molecular weight of 329.38 g/mol. Its IUPAC name is 1-[(2R,3S)-3-(4-nitrophenyl)-4,5-diaza-1-azoniatricyclo[5.2.2.02,6]undec-5-en-4-yl]propan-1-one.
| Compound Name | 1-[(2R,3S)-3-(4-nitrophenyl)-4,5-diaza-1-azoniatricyclo[5.2.2.02,6]undec-5-en-4-yl]propan-1-one |
|---|---|
| PubChem CID | 6943822 |
| Molecular Formula | C17H21N4O3+ |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 1-[(2R,3S)-3-(4-nitrophenyl)-4,5-diaza-1-azoniatricyclo[5.2.2.02,6]undec-5-en-4-yl]propan-1-one |
| SMILES | CCC(=O)N1N=C2C3CC[NH+](CC3)[C@@H]2[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H20N4O3/c1-2-14(22)20-16(12-3-5-13(6-4-12)21(23)24)17-15(18-20)11-7-9-19(17)10-8-11/h3-6,11,16-17H,2,7-10H2,1H3/p+1/t16-,17-/m0/s1 |
| InChIKey | SUQLDIGMLLWLIT-IRXDYDNUSA-O |
| XLogP | 0.92 |
| TPSA | 80.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|