C6H8N6 — CID 69462236
imidazo[1,5-b]pyridazine-3,5,7-triamine (PubChem CID 69462236) has the molecular formula C6H8N6 and a molecular weight of 164.17 g/mol. Its IUPAC name is imidazo[1,5-b]pyridazine-3,5,7-triamine.
| Compound Name | imidazo[1,5-b]pyridazine-3,5,7-triamine |
|---|---|
| PubChem CID | 69462236 |
| Molecular Formula | C6H8N6 |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | imidazo[1,5-b]pyridazine-3,5,7-triamine |
| SMILES | Nc1cnn2c(N)nc(N)c2c1 |
| InChI | InChI=1S/C6H8N6/c7-3-1-4-5(8)11-6(9)12(4)10-2-3/h1-2H,7-8H2,(H2,9,11) |
| InChIKey | STGSUEKDBPOKMU-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |