About benzimidazolo[2,1-a]phthalazin-10-amine
benzimidazolo[2,1-a]phthalazin-10-amine (PubChem CID 5304821) has the molecular formula C14H10N4
and a molecular weight of 234.26 g/mol. Its IUPAC name is benzimidazolo[2,1-a]phthalazin-10-amine.
Molecular Properties
| Compound Name | benzimidazolo[2,1-a]phthalazin-10-amine |
| PubChem CID | 5304821 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | benzimidazolo[2,1-a]phthalazin-10-amine |
| SMILES | Nc1ccc2c(c1)nc1c3ccccc3cnn21 |
| InChI | InChI=1S/C14H10N4/c15-10-5-6-13-12(7-10)17-14-11-4-2-1-3-9(11)8-16-18(13)14/h1-8H,15H2 |
| InChIKey | QGSUPDVDIRBVKZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzimidazolo[2,1-a]phthalazin-10-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzimidazolo[2,1-a]phthalazin-10-amine?
The IUPAC name of benzimidazolo[2,1-a]phthalazin-10-amine (CID 5304821) is benzimidazolo[2,1-a]phthalazin-10-amine.
What is the SMILES notation for benzimidazolo[2,1-a]phthalazin-10-amine?
The canonical SMILES for benzimidazolo[2,1-a]phthalazin-10-amine is Nc1ccc2c(c1)nc1c3ccccc3cnn21.
What is the InChIKey of benzimidazolo[2,1-a]phthalazin-10-amine?
The InChIKey is QGSUPDVDIRBVKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4/c15-10-5-6-13-12(7-10)17-14-11-4-2-1-3-9(11)8-16-18(13)14/h1-8H,15H2.
What are the key properties of benzimidazolo[2,1-a]phthalazin-10-amine?
benzimidazolo[2,1-a]phthalazin-10-amine has a molecular weight of 234.26 g/mol, XLogP of 2.62, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzimidazolo[2,1-a]phthalazin-10-amine is sourced from PubChem (CID 5304821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).